C20H22Cl2N2O4 — CID 67479140
(3R,4S)-4-[6-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-3-pyridinyl]piperidine-3-carboxylic acid (PubChem CID 67479140) has the molecular formula C20H22Cl2N2O4 and a molecular weight of 425.31 g/mol. Its IUPAC name is (3R,4S)-4-[6-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-3-pyridinyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4S)-4-[6-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-3-pyridinyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 67479140 |
| Molecular Formula | C20H22Cl2N2O4 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | (3R,4S)-4-[6-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-3-pyridinyl]piperidine-3-carboxylic acid |
| SMILES | Cc1cc(Cl)c(OCCOc2ccc([C@H]3CCNC[C@@H]3C(=O)O)cn2)c(Cl)c1 |
| InChI | InChI=1S/C20H22Cl2N2O4/c1-12-8-16(21)19(17(22)9-12)28-7-6-27-18-3-2-13(10-24-18)14-4-5-23-11-15(14)20(25)26/h2-3,8-10,14-15,23H,4-7,11H2,1H3,(H,25,26)/t14-,15+/m1/s1 |
| InChIKey | ODEQFNDYFJIQQN-CABCVRRESA-N |
| XLogP | 3.93 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|