C22H24Cl2N2O6 — CID 142760520
4-[6-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-3-pyridinyl]-3-methoxycarbonylpiperidine-1-carboxylic acid (PubChem CID 142760520) has the molecular formula C22H24Cl2N2O6 and a molecular weight of 483.35 g/mol. Its IUPAC name is 4-[6-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-3-pyridinyl]-3-methoxycarbonylpiperidine-1-carboxylic acid.
| Compound Name | 4-[6-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-3-pyridinyl]-3-methoxycarbonylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 142760520 |
| Molecular Formula | C22H24Cl2N2O6 |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 4-[6-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]-3-pyridinyl]-3-methoxycarbonylpiperidine-1-carboxylic acid |
| SMILES | COC(=O)C1CN(C(=O)O)CCC1c1ccc(OCCOc2c(Cl)cc(C)cc2Cl)nc1 |
| InChI | InChI=1S/C22H24Cl2N2O6/c1-13-9-17(23)20(18(24)10-13)32-8-7-31-19-4-3-14(11-25-19)15-5-6-26(22(28)29)12-16(15)21(27)30-2/h3-4,9-11,15-16H,5-8,12H2,1-2H3,(H,28,29) |
| InChIKey | JMBXAERWCBAERD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|