C51H72O4 — CID 177395046
1,3-ditert-butyl-5-[[4-[9-[4-[(3,5-ditert-butylphenoxy)methyl]phenoxy]nonoxy]phenyl]methoxy]benzene (PubChem CID 177395046) has the molecular formula C51H72O4 and a molecular weight of 749.13 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-[[4-[9-[4-[(3,5-ditert-butylphenoxy)methyl]phenoxy]nonoxy]phenyl]methoxy]benzene.
| Compound Name | 1,3-ditert-butyl-5-[[4-[9-[4-[(3,5-ditert-butylphenoxy)methyl]phenoxy]nonoxy]phenyl]methoxy]benzene |
|---|---|
| PubChem CID | 177395046 |
| Molecular Formula | C51H72O4 |
| Molecular Weight | 749.13 g/mol |
| Exact Mass | 748.54 |
| IUPAC Name | 1,3-ditert-butyl-5-[[4-[9-[4-[(3,5-ditert-butylphenoxy)methyl]phenoxy]nonoxy]phenyl]methoxy]benzene |
| SMILES | CC(C)(C)c1cc(OCc2ccc(OCCCCCCCCCOc3ccc(COc4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc3)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C51H72O4/c1-48(2,3)40-30-41(49(4,5)6)33-46(32-40)54-36-38-20-24-44(25-21-38)52-28-18-16-14-13-15-17-19-29-53-45-26-22-39(23-27-45)37-55-47-34-42(50(7,8)9)31-43(35-47)51(10,11)12/h20-27,30-35H,13-19,28-29,36-37H2,1-12H3 |
| InChIKey | JXVANYAGANCVKO-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.13 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|