C84H128I2P2Pd+2 — CID 153412297
diiodopalladium;bis(tris(3,5-ditert-butylphenyl)phosphanium) (PubChem CID 153412297) has the molecular formula C84H128I2P2Pd+2 and a molecular weight of 1560.12 g/mol. Its IUPAC name is diiodopalladium;bis(tris(3,5-ditert-butylphenyl)phosphanium).
| Compound Name | diiodopalladium;bis(tris(3,5-ditert-butylphenyl)phosphanium) |
|---|---|
| PubChem CID | 153412297 |
| Molecular Formula | C84H128I2P2Pd+2 |
| Molecular Weight | 1560.12 g/mol |
| Exact Mass | 1558.66 |
| IUPAC Name | diiodopalladium;bis(tris(3,5-ditert-butylphenyl)phosphanium) |
| SMILES | CC(C)(C)c1cc([PH+](c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1.CC(C)(C)c1cc([PH+](c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1.I[Pd]I |
| InChI | InChI=1S/2C42H63P.2HI.Pd/c2*1-37(2,3)28-19-29(38(4,5)6)23-34(22-28)43(35-24-30(39(7,8)9)20-31(25-35)40(10,11)12)36-26-32(41(13,14)15)21-33(27-36)42(16,17)18;;;/h2*19-27H,1-18H3;2*1H;/q;;;;+2 |
| InChIKey | AULSCOLNEGGXPU-UHFFFAOYSA-N |
| XLogP | 23.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1560.12 |
| LogP ≤ 5 | 23.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|