C59H84Cl2FeP2+2 — CID 158178429
[2-bis(3,5-ditert-butylphenyl)phosphaniumylphenyl]-(3-tert-butyl-5-methylphenyl)-(3,5-ditert-butylphenyl)phosphanium;dichloroiron (PubChem CID 158178429) has the molecular formula C59H84Cl2FeP2+2 and a molecular weight of 982.02 g/mol. Its IUPAC name is [2-bis(3,5-ditert-butylphenyl)phosphaniumylphenyl]-(3-tert-butyl-5-methylphenyl)-(3,5-ditert-butylphenyl)phosphanium;dichloroiron.
| Compound Name | [2-bis(3,5-ditert-butylphenyl)phosphaniumylphenyl]-(3-tert-butyl-5-methylphenyl)-(3,5-ditert-butylphenyl)phosphanium;dichloroiron |
|---|---|
| PubChem CID | 158178429 |
| Molecular Formula | C59H84Cl2FeP2+2 |
| Molecular Weight | 982.02 g/mol |
| Exact Mass | 980.48 |
| IUPAC Name | [2-bis(3,5-ditert-butylphenyl)phosphaniumylphenyl]-(3-tert-butyl-5-methylphenyl)-(3,5-ditert-butylphenyl)phosphanium;dichloroiron |
| SMILES | Cc1cc([PH+](c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2ccccc2[PH+](c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1.Cl[Fe]Cl |
| InChI | InChI=1S/C59H82P2.2ClH.Fe/c1-39-27-40(53(2,3)4)32-47(28-39)60(48-33-41(54(5,6)7)29-42(34-48)55(8,9)10)51-25-23-24-26-52(51)61(49-35-43(56(11,12)13)30-44(36-49)57(14,15)16)50-37-45(58(17,18)19)31-46(38-50)59(20,21)22;;;/h23-38H,1-22H3;2*1H;/q;;;+2 |
| InChIKey | QTTOXFZKECLTBQ-UHFFFAOYSA-N |
| XLogP | 15.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.02 |
| LogP ≤ 5 | 15.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|