About 2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene
2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene (PubChem CID 162242275) has the molecular formula C37H51Cl
and a molecular weight of 531.27 g/mol. Its IUPAC name is 2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene.
Molecular Properties
| Compound Name | 2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene |
| PubChem CID | 162242275 |
| Molecular Formula | C37H51Cl |
| Molecular Weight | 531.27 g/mol |
| Exact Mass | 530.37 |
| IUPAC Name | 2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene |
| SMILES | Cc1cc(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)c(Cl)c(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C37H51Cl/c1-24-14-27(16-25-18-29(34(2,3)4)22-30(19-25)35(5,6)7)33(38)28(15-24)17-26-20-31(36(8,9)10)23-32(21-26)37(11,12)13/h14-15,18-23H,16-17H2,1-13H3 |
| InChIKey | AOFIEFPVYMHELQ-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.27 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene?
The IUPAC name of 2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene (CID 162242275) is 2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene.
What is the SMILES notation for 2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene?
The canonical SMILES for 2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene is Cc1cc(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)c(Cl)c(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1.
What is the InChIKey of 2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene?
The InChIKey is AOFIEFPVYMHELQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H51Cl/c1-24-14-27(16-25-18-29(34(2,3)4)22-30(19-25)35(5,6)7)33(38)28(15-24)17-26-20-31(36(8,9)10)23-32(21-26)37(11,12)13/h14-15,18-23H,16-17H2,1-13H3.
What are the key properties of 2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene?
2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene has a molecular weight of 531.27 g/mol, XLogP of 11.02, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3-bis[(3,5-ditert-butylphenyl)methyl]-5-methylbenzene is sourced from PubChem (CID 162242275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).