C21H19Cl — CID 159286619
1,3-dibenzyl-2-chloro-5-methylbenzene (PubChem CID 159286619) has the molecular formula C21H19Cl and a molecular weight of 306.84 g/mol. Its IUPAC name is 1,3-dibenzyl-2-chloro-5-methylbenzene.
| Compound Name | 1,3-dibenzyl-2-chloro-5-methylbenzene |
|---|---|
| PubChem CID | 159286619 |
| Molecular Formula | C21H19Cl |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1,3-dibenzyl-2-chloro-5-methylbenzene |
| SMILES | Cc1cc(Cc2ccccc2)c(Cl)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H19Cl/c1-16-12-19(14-17-8-4-2-5-9-17)21(22)20(13-16)15-18-10-6-3-7-11-18/h2-13H,14-15H2,1H3 |
| InChIKey | UQLRSCOTGALGJO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |