About 1-benzyl-2-chloro-3-methylbenzene;isocyanic acid
1-benzyl-2-chloro-3-methylbenzene;isocyanic acid (PubChem CID 88621188) has the molecular formula C16H15ClN2O2
and a molecular weight of 302.76 g/mol. Its IUPAC name is 1-benzyl-2-chloro-3-methylbenzene;isocyanic acid.
Molecular Properties
| Compound Name | 1-benzyl-2-chloro-3-methylbenzene;isocyanic acid |
| PubChem CID | 88621188 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 1-benzyl-2-chloro-3-methylbenzene;isocyanic acid |
| SMILES | Cc1cccc(Cc2ccccc2)c1Cl.N=C=O.N=C=O |
| InChI | InChI=1S/C14H13Cl.2CHNO/c1-11-6-5-9-13(14(11)15)10-12-7-3-2-4-8-12;2*2-1-3/h2-9H,10H2,1H3;2*2H |
| InChIKey | ZCPLRVCCBBHHFC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2-chloro-3-methylbenzene;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-chloro-3-methylbenzene;isocyanic acid?
The IUPAC name of 1-benzyl-2-chloro-3-methylbenzene;isocyanic acid (CID 88621188) is 1-benzyl-2-chloro-3-methylbenzene;isocyanic acid.
What is the SMILES notation for 1-benzyl-2-chloro-3-methylbenzene;isocyanic acid?
The canonical SMILES for 1-benzyl-2-chloro-3-methylbenzene;isocyanic acid is Cc1cccc(Cc2ccccc2)c1Cl.N=C=O.N=C=O.
What is the InChIKey of 1-benzyl-2-chloro-3-methylbenzene;isocyanic acid?
The InChIKey is ZCPLRVCCBBHHFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl.2CHNO/c1-11-6-5-9-13(14(11)15)10-12-7-3-2-4-8-12;2*2-1-3/h2-9H,10H2,1H3;2*2H.
What are the key properties of 1-benzyl-2-chloro-3-methylbenzene;isocyanic acid?
1-benzyl-2-chloro-3-methylbenzene;isocyanic acid has a molecular weight of 302.76 g/mol, XLogP of 4.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-chloro-3-methylbenzene;isocyanic acid is sourced from PubChem (CID 88621188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).