C19H19N — CID 15643956
1-(2-benzylphenyl)-2,5-dimethylpyrrole (PubChem CID 15643956) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-(2-benzylphenyl)-2,5-dimethylpyrrole.
| Compound Name | 1-(2-benzylphenyl)-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 15643956 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-(2-benzylphenyl)-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1-c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C19H19N/c1-15-12-13-16(2)20(15)19-11-7-6-10-18(19)14-17-8-4-3-5-9-17/h3-13H,14H2,1-2H3 |
| InChIKey | NTIKOEJOCFRUDZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|