C15H20ClN — CID 174867327
azane;1-benzyl-2,3-dimethylbenzene;hydrochloride (PubChem CID 174867327) has the molecular formula C15H20ClN and a molecular weight of 249.79 g/mol. Its IUPAC name is azane;1-benzyl-2,3-dimethylbenzene;hydrochloride.
| Compound Name | azane;1-benzyl-2,3-dimethylbenzene;hydrochloride |
|---|---|
| PubChem CID | 174867327 |
| Molecular Formula | C15H20ClN |
| Molecular Weight | 249.79 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | azane;1-benzyl-2,3-dimethylbenzene;hydrochloride |
| SMILES | Cc1cccc(Cc2ccccc2)c1C.Cl.N |
| InChI | InChI=1S/C15H16.ClH.H3N/c1-12-7-6-10-15(13(12)2)11-14-8-4-3-5-9-14;;/h3-10H,11H2,1-2H3;1H;1H3 |
| InChIKey | UHVBHDVQHCETLR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.79 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |