C9H11F — CID 15724442
1-(fluoromethyl)-2,3-dimethylbenzene (PubChem CID 15724442) has the molecular formula C9H11F and a molecular weight of 138.18 g/mol. Its IUPAC name is 1-(fluoromethyl)-2,3-dimethylbenzene.
| Compound Name | 1-(fluoromethyl)-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 15724442 |
| Molecular Formula | C9H11F |
| Molecular Weight | 138.18 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 1-(fluoromethyl)-2,3-dimethylbenzene |
| SMILES | Cc1cccc(CF)c1C |
| InChI | InChI=1S/C9H11F/c1-7-4-3-5-9(6-10)8(7)2/h3-5H,6H2,1-2H3 |
| InChIKey | FWXBDZFPOLDDLN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |