C11H15Br — CID 59407640
1-(3-bromopropyl)-2,3-dimethylbenzene (PubChem CID 59407640) has the molecular formula C11H15Br and a molecular weight of 227.14 g/mol. Its IUPAC name is 1-(3-bromopropyl)-2,3-dimethylbenzene.
| Compound Name | 1-(3-bromopropyl)-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 59407640 |
| Molecular Formula | C11H15Br |
| Molecular Weight | 227.14 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 1-(3-bromopropyl)-2,3-dimethylbenzene |
| SMILES | Cc1cccc(CCCBr)c1C |
| InChI | InChI=1S/C11H15Br/c1-9-5-3-6-11(10(9)2)7-4-8-12/h3,5-6H,4,7-8H2,1-2H3 |
| InChIKey | CPTZYKPOMOUZHQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.14 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|