C27H26BrP — CID 87191427
1-(bromomethyl)-2,3-dimethylbenzene;triphenylphosphane (PubChem CID 87191427) has the molecular formula C27H26BrP and a molecular weight of 461.38 g/mol. Its IUPAC name is 1-(bromomethyl)-2,3-dimethylbenzene;triphenylphosphane.
| Compound Name | 1-(bromomethyl)-2,3-dimethylbenzene;triphenylphosphane |
|---|---|
| PubChem CID | 87191427 |
| Molecular Formula | C27H26BrP |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 1-(bromomethyl)-2,3-dimethylbenzene;triphenylphosphane |
| SMILES | Cc1cccc(CBr)c1C.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C9H11Br/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-4-3-5-9(6-10)8(7)2/h1-15H;3-5H,6H2,1-2H3 |
| InChIKey | NRHXBXSILQBLCU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|