About trichlororhodium;triphenylphosphane;1,2-xylene
trichlororhodium;triphenylphosphane;1,2-xylene (PubChem CID 174728734) has the molecular formula C26H25Cl3PRh
and a molecular weight of 577.73 g/mol. Its IUPAC name is trichlororhodium;triphenylphosphane;1,2-xylene.
Molecular Properties
| Compound Name | trichlororhodium;triphenylphosphane;1,2-xylene |
| PubChem CID | 174728734 |
| Molecular Formula | C26H25Cl3PRh |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 575.98 |
| IUPAC Name | trichlororhodium;triphenylphosphane;1,2-xylene |
| SMILES | Cc1ccccc1C.Cl[Rh](Cl)Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C8H10.3ClH.Rh/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-4-6-8(7)2;;;;/h1-15H;3-6H,1-2H3;3*1H;/q;;;;;+3/p-3 |
| InChIKey | VUKWBVLLGFFDBL-UHFFFAOYSA-K |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trichlororhodium;triphenylphosphane;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichlororhodium;triphenylphosphane;1,2-xylene?
The IUPAC name of trichlororhodium;triphenylphosphane;1,2-xylene (CID 174728734) is trichlororhodium;triphenylphosphane;1,2-xylene.
What is the SMILES notation for trichlororhodium;triphenylphosphane;1,2-xylene?
The canonical SMILES for trichlororhodium;triphenylphosphane;1,2-xylene is Cc1ccccc1C.Cl[Rh](Cl)Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of trichlororhodium;triphenylphosphane;1,2-xylene?
The InChIKey is VUKWBVLLGFFDBL-UHFFFAOYSA-K. The full InChI is InChI=1S/C18H15P.C8H10.3ClH.Rh/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-4-6-8(7)2;;;;/h1-15H;3-6H,1-2H3;3*1H;/q;;;;;+3/p-3.
What are the key properties of trichlororhodium;triphenylphosphane;1,2-xylene?
trichlororhodium;triphenylphosphane;1,2-xylene has a molecular weight of 577.73 g/mol, XLogP of 7.81, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichlororhodium;triphenylphosphane;1,2-xylene is sourced from PubChem (CID 174728734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).