About triphenylphosphane;yttrium
triphenylphosphane;yttrium (PubChem CID 139917776) has the molecular formula C18H15PY
and a molecular weight of 351.20 g/mol. Its IUPAC name is triphenylphosphane;yttrium.
Molecular Properties
| Compound Name | triphenylphosphane;yttrium |
| PubChem CID | 139917776 |
| Molecular Formula | C18H15PY |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | triphenylphosphane;yttrium |
| SMILES | [Y].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.Y/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H; |
| InChIKey | GNRLWXDPKIGCBU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triphenylphosphane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylphosphane;yttrium?
The IUPAC name of triphenylphosphane;yttrium (CID 139917776) is triphenylphosphane;yttrium.
What is the SMILES notation for triphenylphosphane;yttrium?
The canonical SMILES for triphenylphosphane;yttrium is [Y].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of triphenylphosphane;yttrium?
The InChIKey is GNRLWXDPKIGCBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.Y/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;.
What are the key properties of triphenylphosphane;yttrium?
triphenylphosphane;yttrium has a molecular weight of 351.20 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylphosphane;yttrium is sourced from PubChem (CID 139917776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).