About ruthenium(2+);triphenylphosphane;chloride
ruthenium(2+);triphenylphosphane;chloride (PubChem CID 56645241) has the molecular formula C18H15ClPRu+
and a molecular weight of 398.82 g/mol. Its IUPAC name is ruthenium(2+);triphenylphosphane;chloride.
Molecular Properties
| Compound Name | ruthenium(2+);triphenylphosphane;chloride |
| PubChem CID | 56645241 |
| Molecular Formula | C18H15ClPRu+ |
| Molecular Weight | 398.82 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | ruthenium(2+);triphenylphosphane;chloride |
| SMILES | [Cl-].[Ru+2].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;1H;/q;;+2/p-1 |
| InChIKey | ZSNSPTRSMWAKDE-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.82 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ruthenium(2+);triphenylphosphane;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ruthenium(2+);triphenylphosphane;chloride?
The IUPAC name of ruthenium(2+);triphenylphosphane;chloride (CID 56645241) is ruthenium(2+);triphenylphosphane;chloride.
What is the SMILES notation for ruthenium(2+);triphenylphosphane;chloride?
The canonical SMILES for ruthenium(2+);triphenylphosphane;chloride is [Cl-].[Ru+2].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of ruthenium(2+);triphenylphosphane;chloride?
The InChIKey is ZSNSPTRSMWAKDE-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15P.ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;1H;/q;;+2/p-1.
What are the key properties of ruthenium(2+);triphenylphosphane;chloride?
ruthenium(2+);triphenylphosphane;chloride has a molecular weight of 398.82 g/mol, XLogP of 0.45, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ruthenium(2+);triphenylphosphane;chloride is sourced from PubChem (CID 56645241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).