About copper;triphenylphosphane;diiodide
copper;triphenylphosphane;diiodide (PubChem CID 175718696) has the molecular formula C18H15CuI2P
and a molecular weight of 579.65 g/mol. Its IUPAC name is copper;triphenylphosphane;diiodide.
Molecular Properties
| Compound Name | copper;triphenylphosphane;diiodide |
| PubChem CID | 175718696 |
| Molecular Formula | C18H15CuI2P |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 578.83 |
| IUPAC Name | copper;triphenylphosphane;diiodide |
| SMILES | [Cu+2].[I-].[I-].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.Cu.2HI/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h1-15H;;2*1H/q;+2;;/p-2 |
| InChIKey | NYJPLCCOZUGBIS-UHFFFAOYSA-L |
| XLogP | -2.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze copper;triphenylphosphane;diiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;triphenylphosphane;diiodide?
The IUPAC name of copper;triphenylphosphane;diiodide (CID 175718696) is copper;triphenylphosphane;diiodide.
What is the SMILES notation for copper;triphenylphosphane;diiodide?
The canonical SMILES for copper;triphenylphosphane;diiodide is [Cu+2].[I-].[I-].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of copper;triphenylphosphane;diiodide?
The InChIKey is NYJPLCCOZUGBIS-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H15P.Cu.2HI/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h1-15H;;2*1H/q;+2;;/p-2.
What are the key properties of copper;triphenylphosphane;diiodide?
copper;triphenylphosphane;diiodide has a molecular weight of 579.65 g/mol, XLogP of -2.55, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper;triphenylphosphane;diiodide is sourced from PubChem (CID 175718696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).