About plutonium;triphenylphosphane
plutonium;triphenylphosphane (PubChem CID 161300359) has the molecular formula C18H15PPu
and a molecular weight of 506.29 g/mol. Its IUPAC name is plutonium;triphenylphosphane.
Molecular Properties
| Compound Name | plutonium;triphenylphosphane |
| PubChem CID | 161300359 |
| Molecular Formula | C18H15PPu |
| Molecular Weight | 506.29 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | plutonium;triphenylphosphane |
| SMILES | [Pu].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.Pu/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H; |
| InChIKey | VHNICBZJVGZTTK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze plutonium;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of plutonium;triphenylphosphane?
The IUPAC name of plutonium;triphenylphosphane (CID 161300359) is plutonium;triphenylphosphane.
What is the SMILES notation for plutonium;triphenylphosphane?
The canonical SMILES for plutonium;triphenylphosphane is [Pu].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of plutonium;triphenylphosphane?
The InChIKey is VHNICBZJVGZTTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.Pu/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;.
What are the key properties of plutonium;triphenylphosphane?
plutonium;triphenylphosphane has a molecular weight of 506.29 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for plutonium;triphenylphosphane is sourced from PubChem (CID 161300359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).