About triphenylphosphane;octahydrochloride
triphenylphosphane;octahydrochloride (PubChem CID 172751742) has the molecular formula C18H23Cl8P
and a molecular weight of 553.98 g/mol. Its IUPAC name is triphenylphosphane;octahydrochloride.
Molecular Properties
| Compound Name | triphenylphosphane;octahydrochloride |
| PubChem CID | 172751742 |
| Molecular Formula | C18H23Cl8P |
| Molecular Weight | 553.98 g/mol |
| Exact Mass | 549.90 |
| IUPAC Name | triphenylphosphane;octahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.Cl.Cl.Cl.Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.8ClH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;;;/h1-15H;8*1H |
| InChIKey | KLVBVUFNETWLGD-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 553.98 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triphenylphosphane;octahydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylphosphane;octahydrochloride?
The IUPAC name of triphenylphosphane;octahydrochloride (CID 172751742) is triphenylphosphane;octahydrochloride.
What is the SMILES notation for triphenylphosphane;octahydrochloride?
The canonical SMILES for triphenylphosphane;octahydrochloride is Cl.Cl.Cl.Cl.Cl.Cl.Cl.Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of triphenylphosphane;octahydrochloride?
The InChIKey is KLVBVUFNETWLGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.8ClH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;;;/h1-15H;8*1H.
What are the key properties of triphenylphosphane;octahydrochloride?
triphenylphosphane;octahydrochloride has a molecular weight of 553.98 g/mol, XLogP of 6.82, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylphosphane;octahydrochloride is sourced from PubChem (CID 172751742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).