About ethane;triphenylphosphane
ethane;triphenylphosphane (PubChem CID 90942156) has the molecular formula C22H27P
and a molecular weight of 322.43 g/mol. Its IUPAC name is ethane;triphenylphosphane.
Molecular Properties
| Compound Name | ethane;triphenylphosphane |
| PubChem CID | 90942156 |
| Molecular Formula | C22H27P |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | ethane;triphenylphosphane |
| SMILES | CC.CC.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.2C2H6/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*1-2/h1-15H;2*1-2H3 |
| InChIKey | KPBIBWLFBQVOOW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;triphenylphosphane?
The IUPAC name of ethane;triphenylphosphane (CID 90942156) is ethane;triphenylphosphane.
What is the SMILES notation for ethane;triphenylphosphane?
The canonical SMILES for ethane;triphenylphosphane is CC.CC.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of ethane;triphenylphosphane?
The InChIKey is KPBIBWLFBQVOOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.2C2H6/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*1-2/h1-15H;2*1-2H3.
What are the key properties of ethane;triphenylphosphane?
ethane;triphenylphosphane has a molecular weight of 322.43 g/mol, XLogP of 5.50, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;triphenylphosphane is sourced from PubChem (CID 90942156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).