C15H20N2 — CID 70557696
2-[3-(2,3-dimethylphenyl)propyl]-5-methyl-1H-imidazole (PubChem CID 70557696) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-[3-(2,3-dimethylphenyl)propyl]-5-methyl-1H-imidazole.
| Compound Name | 2-[3-(2,3-dimethylphenyl)propyl]-5-methyl-1H-imidazole |
|---|---|
| PubChem CID | 70557696 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2-[3-(2,3-dimethylphenyl)propyl]-5-methyl-1H-imidazole |
| SMILES | Cc1cnc(CCCc2cccc(C)c2C)[nH]1 |
| InChI | InChI=1S/C15H20N2/c1-11-6-4-7-14(13(11)3)8-5-9-15-16-10-12(2)17-15/h4,6-7,10H,5,8-9H2,1-3H3,(H,16,17) |
| InChIKey | QBBKPXVEOBMQLU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |