About 5-methyl-2-octyl-1H-imidazole;hydrate
5-methyl-2-octyl-1H-imidazole;hydrate (PubChem CID 172776370) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 5-methyl-2-octyl-1H-imidazole;hydrate.
Molecular Properties
| Compound Name | 5-methyl-2-octyl-1H-imidazole;hydrate |
| PubChem CID | 172776370 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 5-methyl-2-octyl-1H-imidazole;hydrate |
| SMILES | CCCCCCCCc1ncc(C)[nH]1.O |
| InChI | InChI=1S/C12H22N2.H2O/c1-3-4-5-6-7-8-9-12-13-10-11(2)14-12;/h10H,3-9H2,1-2H3,(H,13,14);1H2 |
| InChIKey | NQNPSCQAIIUOMU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-octyl-1H-imidazole;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-octyl-1H-imidazole;hydrate?
The IUPAC name of 5-methyl-2-octyl-1H-imidazole;hydrate (CID 172776370) is 5-methyl-2-octyl-1H-imidazole;hydrate.
What is the SMILES notation for 5-methyl-2-octyl-1H-imidazole;hydrate?
The canonical SMILES for 5-methyl-2-octyl-1H-imidazole;hydrate is CCCCCCCCc1ncc(C)[nH]1.O.
What is the InChIKey of 5-methyl-2-octyl-1H-imidazole;hydrate?
The InChIKey is NQNPSCQAIIUOMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2.H2O/c1-3-4-5-6-7-8-9-12-13-10-11(2)14-12;/h10H,3-9H2,1-2H3,(H,13,14);1H2.
What are the key properties of 5-methyl-2-octyl-1H-imidazole;hydrate?
5-methyl-2-octyl-1H-imidazole;hydrate has a molecular weight of 212.34 g/mol, XLogP of 2.80, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-octyl-1H-imidazole;hydrate is sourced from PubChem (CID 172776370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).