C17H32N2O2 — CID 175376233
acetic acid;2,5-dihexyl-1H-imidazole (PubChem CID 175376233) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is acetic acid;2,5-dihexyl-1H-imidazole.
| Compound Name | acetic acid;2,5-dihexyl-1H-imidazole |
|---|---|
| PubChem CID | 175376233 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | acetic acid;2,5-dihexyl-1H-imidazole |
| SMILES | CC(=O)O.CCCCCCc1cnc(CCCCCC)[nH]1 |
| InChI | InChI=1S/C15H28N2.C2H4O2/c1-3-5-7-9-11-14-13-16-15(17-14)12-10-8-6-4-2;1-2(3)4/h13H,3-12H2,1-2H3,(H,16,17);1H3,(H,3,4) |
| InChIKey | CLSREZBAINGUOZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|