About 2-methyl-5-octadecyl-1H-imidazole;hydrobromide
2-methyl-5-octadecyl-1H-imidazole;hydrobromide (PubChem CID 174843690) has the molecular formula C22H43BrN2
and a molecular weight of 415.50 g/mol. Its IUPAC name is 2-methyl-5-octadecyl-1H-imidazole;hydrobromide.
Molecular Properties
| Compound Name | 2-methyl-5-octadecyl-1H-imidazole;hydrobromide |
| PubChem CID | 174843690 |
| Molecular Formula | C22H43BrN2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 2-methyl-5-octadecyl-1H-imidazole;hydrobromide |
| SMILES | Br.CCCCCCCCCCCCCCCCCCc1cnc(C)[nH]1 |
| InChI | InChI=1S/C22H42N2.BrH/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20-23-21(2)24-22;/h20H,3-19H2,1-2H3,(H,23,24);1H |
| InChIKey | UVSURCXNQJZAAH-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-octadecyl-1H-imidazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-octadecyl-1H-imidazole;hydrobromide?
The IUPAC name of 2-methyl-5-octadecyl-1H-imidazole;hydrobromide (CID 174843690) is 2-methyl-5-octadecyl-1H-imidazole;hydrobromide.
What is the SMILES notation for 2-methyl-5-octadecyl-1H-imidazole;hydrobromide?
The canonical SMILES for 2-methyl-5-octadecyl-1H-imidazole;hydrobromide is Br.CCCCCCCCCCCCCCCCCCc1cnc(C)[nH]1.
What is the InChIKey of 2-methyl-5-octadecyl-1H-imidazole;hydrobromide?
The InChIKey is UVSURCXNQJZAAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42N2.BrH/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20-23-21(2)24-22;/h20H,3-19H2,1-2H3,(H,23,24);1H.
What are the key properties of 2-methyl-5-octadecyl-1H-imidazole;hydrobromide?
2-methyl-5-octadecyl-1H-imidazole;hydrobromide has a molecular weight of 415.50 g/mol, XLogP of 8.10, 17 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-octadecyl-1H-imidazole;hydrobromide is sourced from PubChem (CID 174843690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).