C10H20N2O4S — CID 175268220
2-hexyl-5-methyl-1H-imidazole;sulfuric acid (PubChem CID 175268220) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-hexyl-5-methyl-1H-imidazole;sulfuric acid.
| Compound Name | 2-hexyl-5-methyl-1H-imidazole;sulfuric acid |
|---|---|
| PubChem CID | 175268220 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-hexyl-5-methyl-1H-imidazole;sulfuric acid |
| SMILES | CCCCCCc1ncc(C)[nH]1.O=S(=O)(O)O |
| InChI | InChI=1S/C10H18N2.H2O4S/c1-3-4-5-6-7-10-11-8-9(2)12-10;1-5(2,3)4/h8H,3-7H2,1-2H3,(H,11,12);(H2,1,2,3,4) |
| InChIKey | DKYKNBZBKBECMS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|