C13H23F3N2O3S — CID 174626345
5-methyl-2-octyl-1H-imidazole;trifluoromethanesulfonic acid (PubChem CID 174626345) has the molecular formula C13H23F3N2O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is 5-methyl-2-octyl-1H-imidazole;trifluoromethanesulfonic acid.
| Compound Name | 5-methyl-2-octyl-1H-imidazole;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 174626345 |
| Molecular Formula | C13H23F3N2O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 5-methyl-2-octyl-1H-imidazole;trifluoromethanesulfonic acid |
| SMILES | CCCCCCCCc1ncc(C)[nH]1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C12H22N2.CHF3O3S/c1-3-4-5-6-7-8-9-12-13-10-11(2)14-12;2-1(3,4)8(5,6)7/h10H,3-9H2,1-2H3,(H,13,14);(H,5,6,7) |
| InChIKey | XQUYFSRVCHMTCI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|