C6H12AlN2O — CID 175233051
CID 175233051 (PubChem CID 175233051) has the molecular formula C6H12AlN2O and a molecular weight of 155.16 g/mol.
| Compound Name | CID 175233051 |
|---|---|
| PubChem CID | 175233051 |
| Molecular Formula | C6H12AlN2O |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | — |
| SMILES | CCc1ncc(C)[nH]1.O.[Al] |
| InChI | InChI=1S/C6H10N2.Al.H2O/c1-3-6-7-4-5(2)8-6;;/h4H,3H2,1-2H3,(H,7,8);;1H2 |
| InChIKey | CZZBABJFHBOPDU-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |