C5H9IN2 — CID 174505466
2,5-dimethyl-1H-imidazole;hydroiodide (PubChem CID 174505466) has the molecular formula C5H9IN2 and a molecular weight of 224.04 g/mol. Its IUPAC name is 2,5-dimethyl-1H-imidazole;hydroiodide.
| Compound Name | 2,5-dimethyl-1H-imidazole;hydroiodide |
|---|---|
| PubChem CID | 174505466 |
| Molecular Formula | C5H9IN2 |
| Molecular Weight | 224.04 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | 2,5-dimethyl-1H-imidazole;hydroiodide |
| SMILES | Cc1cnc(C)[nH]1.I |
| InChI | InChI=1S/C5H8N2.HI/c1-4-3-6-5(2)7-4;/h3H,1-2H3,(H,6,7);1H |
| InChIKey | DJIUTIIZORPCNV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.04 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|