About 2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole
2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole (PubChem CID 159852492) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is 2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole.
Molecular Properties
| Compound Name | 2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole |
| PubChem CID | 159852492 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole |
| SMILES | Cc1cnc(C)[nH]1.Cc1nc[nH]c1C |
| InChI | InChI=1S/2C5H8N2/c1-4-5(2)7-3-6-4;1-4-3-6-5(2)7-4/h2*3H,1-2H3,(H,6,7) |
| InChIKey | NQCPXRORNYAVKQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole?
The IUPAC name of 2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole (CID 159852492) is 2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole.
What is the SMILES notation for 2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole?
The canonical SMILES for 2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole is Cc1cnc(C)[nH]1.Cc1nc[nH]c1C.
What is the InChIKey of 2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole?
The InChIKey is NQCPXRORNYAVKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H8N2/c1-4-5(2)7-3-6-4;1-4-3-6-5(2)7-4/h2*3H,1-2H3,(H,6,7).
What are the key properties of 2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole?
2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole has a molecular weight of 192.27 g/mol, XLogP of 2.05, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1H-imidazole;4,5-dimethyl-1H-imidazole is sourced from PubChem (CID 159852492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).