C9H14N4 — CID 159800988
2,5-dimethyl-1H-imidazole;1-methylimidazole (PubChem CID 159800988) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 2,5-dimethyl-1H-imidazole;1-methylimidazole.
| Compound Name | 2,5-dimethyl-1H-imidazole;1-methylimidazole |
|---|---|
| PubChem CID | 159800988 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2,5-dimethyl-1H-imidazole;1-methylimidazole |
| SMILES | Cc1cnc(C)[nH]1.Cn1ccnc1 |
| InChI | InChI=1S/C5H8N2.C4H6N2/c1-4-3-6-5(2)7-4;1-6-3-2-5-4-6/h3H,1-2H3,(H,6,7);2-4H,1H3 |
| InChIKey | NJTZOYLBMXKUHT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |