About dichloromercury;bis(1-methylimidazole)
dichloromercury;bis(1-methylimidazole) (PubChem CID 67805046) has the molecular formula C8H12Cl2HgN4
and a molecular weight of 435.71 g/mol. Its IUPAC name is dichloromercury;bis(1-methylimidazole).
Molecular Properties
| Compound Name | dichloromercury;bis(1-methylimidazole) |
| PubChem CID | 67805046 |
| Molecular Formula | C8H12Cl2HgN4 |
| Molecular Weight | 435.71 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | dichloromercury;bis(1-methylimidazole) |
| SMILES | Cl[Hg]Cl.Cn1ccnc1.Cn1ccnc1 |
| InChI | InChI=1S/2C4H6N2.2ClH.Hg/c2*1-6-3-2-5-4-6;;;/h2*2-4H,1H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | WKCUKEQHIISQEB-UHFFFAOYSA-L |
| XLogP | 2.22 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.71 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichloromercury;bis(1-methylimidazole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromercury;bis(1-methylimidazole)?
The IUPAC name of dichloromercury;bis(1-methylimidazole) (CID 67805046) is dichloromercury;bis(1-methylimidazole).
What is the SMILES notation for dichloromercury;bis(1-methylimidazole)?
The canonical SMILES for dichloromercury;bis(1-methylimidazole) is Cl[Hg]Cl.Cn1ccnc1.Cn1ccnc1.
What is the InChIKey of dichloromercury;bis(1-methylimidazole)?
The InChIKey is WKCUKEQHIISQEB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H6N2.2ClH.Hg/c2*1-6-3-2-5-4-6;;;/h2*2-4H,1H3;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloromercury;bis(1-methylimidazole)?
dichloromercury;bis(1-methylimidazole) has a molecular weight of 435.71 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromercury;bis(1-methylimidazole) is sourced from PubChem (CID 67805046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).