About 1-methylimidazole;tetrachlorotitanium
1-methylimidazole;tetrachlorotitanium (PubChem CID 174841078) has the molecular formula C4H6Cl4N2Ti
and a molecular weight of 271.79 g/mol. Its IUPAC name is 1-methylimidazole;tetrachlorotitanium.
Molecular Properties
| Compound Name | 1-methylimidazole;tetrachlorotitanium |
| PubChem CID | 174841078 |
| Molecular Formula | C4H6Cl4N2Ti |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 269.88 |
| IUPAC Name | 1-methylimidazole;tetrachlorotitanium |
| SMILES | Cl[Ti](Cl)(Cl)Cl.Cn1ccnc1 |
| InChI | InChI=1S/C4H6N2.4ClH.Ti/c1-6-3-2-5-4-6;;;;;/h2-4H,1H3;4*1H;/q;;;;;+4/p-4 |
| InChIKey | HXAOIZZQFMQATH-UHFFFAOYSA-J |
| XLogP | 3.18 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylimidazole;tetrachlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylimidazole;tetrachlorotitanium?
The IUPAC name of 1-methylimidazole;tetrachlorotitanium (CID 174841078) is 1-methylimidazole;tetrachlorotitanium.
What is the SMILES notation for 1-methylimidazole;tetrachlorotitanium?
The canonical SMILES for 1-methylimidazole;tetrachlorotitanium is Cl[Ti](Cl)(Cl)Cl.Cn1ccnc1.
What is the InChIKey of 1-methylimidazole;tetrachlorotitanium?
The InChIKey is HXAOIZZQFMQATH-UHFFFAOYSA-J. The full InChI is InChI=1S/C4H6N2.4ClH.Ti/c1-6-3-2-5-4-6;;;;;/h2-4H,1H3;4*1H;/q;;;;;+4/p-4.
What are the key properties of 1-methylimidazole;tetrachlorotitanium?
1-methylimidazole;tetrachlorotitanium has a molecular weight of 271.79 g/mol, XLogP of 3.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylimidazole;tetrachlorotitanium is sourced from PubChem (CID 174841078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).