About 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide
2,5-dimethyl-1H-imidazole;phosphane;hydrobromide (PubChem CID 173289689) has the molecular formula C5H12BrN2P
and a molecular weight of 211.04 g/mol. Its IUPAC name is 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide.
Molecular Properties
| Compound Name | 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide |
| PubChem CID | 173289689 |
| Molecular Formula | C5H12BrN2P |
| Molecular Weight | 211.04 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide |
| SMILES | Br.Cc1cnc(C)[nH]1.P |
| InChI | InChI=1S/C5H8N2.BrH.H3P/c1-4-3-6-5(2)7-4;;/h3H,1-2H3,(H,6,7);1H;1H3 |
| InChIKey | UKPZTAFEFPJZCH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.04 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide?
The IUPAC name of 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide (CID 173289689) is 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide.
What is the SMILES notation for 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide?
The canonical SMILES for 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide is Br.Cc1cnc(C)[nH]1.P.
What is the InChIKey of 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide?
The InChIKey is UKPZTAFEFPJZCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.BrH.H3P/c1-4-3-6-5(2)7-4;;/h3H,1-2H3,(H,6,7);1H;1H3.
What are the key properties of 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide?
2,5-dimethyl-1H-imidazole;phosphane;hydrobromide has a molecular weight of 211.04 g/mol, XLogP of 1.66, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide is sourced from PubChem (CID 173289689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).