C5H12BrN2P — CID 173289689
2,5-dimethyl-1H-imidazole;phosphane;hydrobromide (PubChem CID 173289689) has the molecular formula C5H12BrN2P and a molecular weight of 211.04 g/mol. Its IUPAC name is 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide.
| Compound Name | 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide |
|---|---|
| PubChem CID | 173289689 |
| Molecular Formula | C5H12BrN2P |
| Molecular Weight | 211.04 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | 2,5-dimethyl-1H-imidazole;phosphane;hydrobromide |
| SMILES | Br.Cc1cnc(C)[nH]1.P |
| InChI | InChI=1S/C5H8N2.BrH.H3P/c1-4-3-6-5(2)7-4;;/h3H,1-2H3,(H,6,7);1H;1H3 |
| InChIKey | UKPZTAFEFPJZCH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.04 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|