C17H27N3 — CID 159398992
2,5-dimethyl-1H-imidazole;2,6-dimethyl-1H-indole;methane (PubChem CID 159398992) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 2,5-dimethyl-1H-imidazole;2,6-dimethyl-1H-indole;methane.
| Compound Name | 2,5-dimethyl-1H-imidazole;2,6-dimethyl-1H-indole;methane |
|---|---|
| PubChem CID | 159398992 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 2,5-dimethyl-1H-imidazole;2,6-dimethyl-1H-indole;methane |
| SMILES | C.C.Cc1ccc2cc(C)[nH]c2c1.Cc1cnc(C)[nH]1 |
| InChI | InChI=1S/C10H11N.C5H8N2.2CH4/c1-7-3-4-9-6-8(2)11-10(9)5-7;1-4-3-6-5(2)7-4;;/h3-6,11H,1-2H3;3H,1-2H3,(H,6,7);2*1H4 |
| InChIKey | LNCFEJAMKUWPPA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |