C11H16N2 — CID 156750914
2,6-dimethyl-1H-pyrrolo[3,2-c]pyridine;ethane (PubChem CID 156750914) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,6-dimethyl-1H-pyrrolo[3,2-c]pyridine;ethane.
| Compound Name | 2,6-dimethyl-1H-pyrrolo[3,2-c]pyridine;ethane |
|---|---|
| PubChem CID | 156750914 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2,6-dimethyl-1H-pyrrolo[3,2-c]pyridine;ethane |
| SMILES | CC.Cc1cc2[nH]c(C)cc2cn1 |
| InChI | InChI=1S/C9H10N2.C2H6/c1-6-4-9-8(5-10-6)3-7(2)11-9;1-2/h3-5,11H,1-2H3;1-2H3 |
| InChIKey | BQICSVDLQMALBG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |