C12H9N3O2 — CID 12524049
2-methyl-7-nitro-1H-pyrrolo[2,3-g]quinoline (PubChem CID 12524049) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-methyl-7-nitro-1H-pyrrolo[2,3-g]quinoline.
| Compound Name | 2-methyl-7-nitro-1H-pyrrolo[2,3-g]quinoline |
|---|---|
| PubChem CID | 12524049 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-methyl-7-nitro-1H-pyrrolo[2,3-g]quinoline |
| SMILES | Cc1cc2cc3ncc([N+](=O)[O-])cc3cc2[nH]1 |
| InChI | InChI=1S/C12H9N3O2/c1-7-2-8-4-11-9(5-12(8)14-7)3-10(6-13-11)15(16)17/h2-6,14H,1H3 |
| InChIKey | AVPCNRRPLJTQLR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|