C7H5N3O2S — CID 44613613
2-methyl-6-nitro-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 44613613) has the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. Its IUPAC name is 2-methyl-6-nitro-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 2-methyl-6-nitro-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 44613613 |
| Molecular Formula | C7H5N3O2S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 2-methyl-6-nitro-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | Cc1nc2cc([N+](=O)[O-])cnc2s1 |
| InChI | InChI=1S/C7H5N3O2S/c1-4-9-6-2-5(10(11)12)3-8-7(6)13-4/h2-3H,1H3 |
| InChIKey | RIWUNNUSWKGWQR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|