C8H7N3O2S — CID 145450780
2,7-dimethyl-6-nitro-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 145450780) has the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. Its IUPAC name is 2,7-dimethyl-6-nitro-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 2,7-dimethyl-6-nitro-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 145450780 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 2,7-dimethyl-6-nitro-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | Cc1nc2c(C)c([N+](=O)[O-])cnc2s1 |
| InChI | InChI=1S/C8H7N3O2S/c1-4-6(11(12)13)3-9-8-7(4)10-5(2)14-8/h3H,1-2H3 |
| InChIKey | IDDMKBPSUMWWSU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|