C10H9ClN2O2S — CID 158602969
6-chloro-2,4,7-trimethyl-5-nitro-1,3-benzothiazole (PubChem CID 158602969) has the molecular formula C10H9ClN2O2S and a molecular weight of 256.71 g/mol. Its IUPAC name is 6-chloro-2,4,7-trimethyl-5-nitro-1,3-benzothiazole.
| Compound Name | 6-chloro-2,4,7-trimethyl-5-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 158602969 |
| Molecular Formula | C10H9ClN2O2S |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 6-chloro-2,4,7-trimethyl-5-nitro-1,3-benzothiazole |
| SMILES | Cc1nc2c(C)c([N+](=O)[O-])c(Cl)c(C)c2s1 |
| InChI | InChI=1S/C10H9ClN2O2S/c1-4-7(11)9(13(14)15)5(2)8-10(4)16-6(3)12-8/h1-3H3 |
| InChIKey | SEUVUDUKYRVFIR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|