C19H13ClN4O3S — CID 16906091
7-(4-chlorophenyl)-2-methyl-5-[(3-nitrophenyl)methyl]-[1,3]thiazolo[4,5-d]pyridazin-4-one (PubChem CID 16906091) has the molecular formula C19H13ClN4O3S and a molecular weight of 412.86 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-2-methyl-5-[(3-nitrophenyl)methyl]-[1,3]thiazolo[4,5-d]pyridazin-4-one.
| Compound Name | 7-(4-chlorophenyl)-2-methyl-5-[(3-nitrophenyl)methyl]-[1,3]thiazolo[4,5-d]pyridazin-4-one |
|---|---|
| PubChem CID | 16906091 |
| Molecular Formula | C19H13ClN4O3S |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 7-(4-chlorophenyl)-2-methyl-5-[(3-nitrophenyl)methyl]-[1,3]thiazolo[4,5-d]pyridazin-4-one |
| SMILES | Cc1nc2c(=O)n(Cc3cccc([N+](=O)[O-])c3)nc(-c3ccc(Cl)cc3)c2s1 |
| InChI | InChI=1S/C19H13ClN4O3S/c1-11-21-17-18(28-11)16(13-5-7-14(20)8-6-13)22-23(19(17)25)10-12-3-2-4-15(9-12)24(26)27/h2-9H,10H2,1H3 |
| InChIKey | SBUIOGPTEJKOJU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|