C12H10N6O3 — CID 135858813
7-methyl-3-[(3-nitrophenyl)methyl]-6H-pyrazolo[4,3-d]triazin-4-one (PubChem CID 135858813) has the molecular formula C12H10N6O3 and a molecular weight of 286.25 g/mol. Its IUPAC name is 7-methyl-3-[(3-nitrophenyl)methyl]-6H-pyrazolo[4,3-d]triazin-4-one.
| Compound Name | 7-methyl-3-[(3-nitrophenyl)methyl]-6H-pyrazolo[4,3-d]triazin-4-one |
|---|---|
| PubChem CID | 135858813 |
| Molecular Formula | C12H10N6O3 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 7-methyl-3-[(3-nitrophenyl)methyl]-6H-pyrazolo[4,3-d]triazin-4-one |
| SMILES | Cc1[nH]nc2c(=O)n(Cc3cccc([N+](=O)[O-])c3)nnc12 |
| InChI | InChI=1S/C12H10N6O3/c1-7-10-11(14-13-7)12(19)17(16-15-10)6-8-3-2-4-9(5-8)18(20)21/h2-5H,6H2,1H3,(H,13,14) |
| InChIKey | XJIZWIUCFYJURX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|