C15H13N3O4 — CID 10424814
3,4-dimethyl-1-[(3-nitrophenyl)methyl]pyrano[3,2-d]pyrazol-6-one (PubChem CID 10424814) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is 3,4-dimethyl-1-[(3-nitrophenyl)methyl]pyrano[3,2-d]pyrazol-6-one.
| Compound Name | 3,4-dimethyl-1-[(3-nitrophenyl)methyl]pyrano[3,2-d]pyrazol-6-one |
|---|---|
| PubChem CID | 10424814 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3,4-dimethyl-1-[(3-nitrophenyl)methyl]pyrano[3,2-d]pyrazol-6-one |
| SMILES | Cc1cc(=O)oc2c1c(C)nn2Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H13N3O4/c1-9-6-13(19)22-15-14(9)10(2)16-17(15)8-11-4-3-5-12(7-11)18(20)21/h3-7H,8H2,1-2H3 |
| InChIKey | NRPRKXYQFDJPTK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 91.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|