C10H9Cl2N5O2 — CID 114044381
2-chloro-4-(4-chloro-3,5-dimethylpyrazol-1-yl)-6-methyl-5-nitropyrimidine (PubChem CID 114044381) has the molecular formula C10H9Cl2N5O2 and a molecular weight of 302.12 g/mol. Its IUPAC name is 2-chloro-4-(4-chloro-3,5-dimethylpyrazol-1-yl)-6-methyl-5-nitropyrimidine.
| Compound Name | 2-chloro-4-(4-chloro-3,5-dimethylpyrazol-1-yl)-6-methyl-5-nitropyrimidine |
|---|---|
| PubChem CID | 114044381 |
| Molecular Formula | C10H9Cl2N5O2 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 2-chloro-4-(4-chloro-3,5-dimethylpyrazol-1-yl)-6-methyl-5-nitropyrimidine |
| SMILES | Cc1nn(-c2nc(Cl)nc(C)c2[N+](=O)[O-])c(C)c1Cl |
| InChI | InChI=1S/C10H9Cl2N5O2/c1-4-7(11)6(3)16(15-4)9-8(17(18)19)5(2)13-10(12)14-9/h1-3H3 |
| InChIKey | RONXOSQIDSORLN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|