C10H6Cl4N6O4 — CID 131668662
2,4-dichloro-6-methyl-5-nitropyrimidine (PubChem CID 131668662) has the molecular formula C10H6Cl4N6O4 and a molecular weight of 416.01 g/mol. Its IUPAC name is 2,4-dichloro-6-methyl-5-nitropyrimidine.
| Compound Name | 2,4-dichloro-6-methyl-5-nitropyrimidine |
|---|---|
| PubChem CID | 131668662 |
| Molecular Formula | C10H6Cl4N6O4 |
| Molecular Weight | 416.01 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | 2,4-dichloro-6-methyl-5-nitropyrimidine |
| SMILES | Cc1nc(Cl)nc(Cl)c1[N+](=O)[O-].Cc1nc(Cl)nc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/2C5H3Cl2N3O2/c2*1-2-3(10(11)12)4(6)9-5(7)8-2/h2*1H3 |
| InChIKey | QBXDTZBTKXKGST-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 137.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.01 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|