C8H8Cl2N4O2 — CID 106195519
2-chloro-N-(2-chloroprop-2-enyl)-6-methyl-5-nitropyrimidin-4-amine (PubChem CID 106195519) has the molecular formula C8H8Cl2N4O2 and a molecular weight of 263.08 g/mol. Its IUPAC name is 2-chloro-N-(2-chloroprop-2-enyl)-6-methyl-5-nitropyrimidin-4-amine.
| Compound Name | 2-chloro-N-(2-chloroprop-2-enyl)-6-methyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 106195519 |
| Molecular Formula | C8H8Cl2N4O2 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2-chloro-N-(2-chloroprop-2-enyl)-6-methyl-5-nitropyrimidin-4-amine |
| SMILES | C=C(Cl)CNc1nc(Cl)nc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8Cl2N4O2/c1-4(9)3-11-7-6(14(15)16)5(2)12-8(10)13-7/h1,3H2,2H3,(H,11,12,13) |
| InChIKey | NIIBHLCGRXWWPW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|