C10H12ClN5O3 — CID 114043344
4-(2-chloro-6-methyl-5-nitropyrimidin-4-yl)-1,4-diazepan-2-one (PubChem CID 114043344) has the molecular formula C10H12ClN5O3 and a molecular weight of 285.69 g/mol. Its IUPAC name is 4-(2-chloro-6-methyl-5-nitropyrimidin-4-yl)-1,4-diazepan-2-one.
| Compound Name | 4-(2-chloro-6-methyl-5-nitropyrimidin-4-yl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 114043344 |
| Molecular Formula | C10H12ClN5O3 |
| Molecular Weight | 285.69 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 4-(2-chloro-6-methyl-5-nitropyrimidin-4-yl)-1,4-diazepan-2-one |
| SMILES | Cc1nc(Cl)nc(N2CCCNC(=O)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12ClN5O3/c1-6-8(16(18)19)9(14-10(11)13-6)15-4-2-3-12-7(17)5-15/h2-5H2,1H3,(H,12,17) |
| InChIKey | DEJHTAYRTIQTMT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.69 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|