C9H13N7O3 — CID 114045120
4-(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)piperazin-2-one (PubChem CID 114045120) has the molecular formula C9H13N7O3 and a molecular weight of 267.25 g/mol. Its IUPAC name is 4-(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)piperazin-2-one.
| Compound Name | 4-(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)piperazin-2-one |
|---|---|
| PubChem CID | 114045120 |
| Molecular Formula | C9H13N7O3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-(2-hydrazinyl-6-methyl-5-nitropyrimidin-4-yl)piperazin-2-one |
| SMILES | Cc1nc(NN)nc(N2CCNC(=O)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N7O3/c1-5-7(16(18)19)8(13-9(12-5)14-10)15-3-2-11-6(17)4-15/h2-4,10H2,1H3,(H,11,17)(H,12,13,14) |
| InChIKey | XXLWCUWYUGDKFK-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|