C9H11Cl2N5O — CID 102762375
4-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)piperazin-2-one (PubChem CID 102762375) has the molecular formula C9H11Cl2N5O and a molecular weight of 276.13 g/mol. Its IUPAC name is 4-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)piperazin-2-one.
| Compound Name | 4-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)piperazin-2-one |
|---|---|
| PubChem CID | 102762375 |
| Molecular Formula | C9H11Cl2N5O |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 4-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)piperazin-2-one |
| SMILES | NNc1nc(N2CCNC(=O)C2)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H11Cl2N5O/c10-5-3-6(11)9(14-8(5)15-12)16-2-1-13-7(17)4-16/h3H,1-2,4,12H2,(H,13,17)(H,14,15) |
| InChIKey | XJHKWKRRBMXOLW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|