C10H15Cl2N5 — CID 102762367
[3,5-dichloro-6-(4-methylpiperazin-1-yl)-2-pyridinyl]hydrazine (PubChem CID 102762367) has the molecular formula C10H15Cl2N5 and a molecular weight of 276.17 g/mol. Its IUPAC name is [3,5-dichloro-6-(4-methylpiperazin-1-yl)-2-pyridinyl]hydrazine.
| Compound Name | [3,5-dichloro-6-(4-methylpiperazin-1-yl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102762367 |
| Molecular Formula | C10H15Cl2N5 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | [3,5-dichloro-6-(4-methylpiperazin-1-yl)-2-pyridinyl]hydrazine |
| SMILES | CN1CCN(c2nc(NN)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C10H15Cl2N5/c1-16-2-4-17(5-3-16)10-8(12)6-7(11)9(14-10)15-13/h6H,2-5,13H2,1H3,(H,14,15) |
| InChIKey | QVWBVGVPIPUWQQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|