C12H17Cl2N3 — CID 102755321
6-(azepan-1-yl)-3,5-dichloro-N-methylpyridin-2-amine (PubChem CID 102755321) has the molecular formula C12H17Cl2N3 and a molecular weight of 274.19 g/mol. Its IUPAC name is 6-(azepan-1-yl)-3,5-dichloro-N-methylpyridin-2-amine.
| Compound Name | 6-(azepan-1-yl)-3,5-dichloro-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 102755321 |
| Molecular Formula | C12H17Cl2N3 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 6-(azepan-1-yl)-3,5-dichloro-N-methylpyridin-2-amine |
| SMILES | CNc1nc(N2CCCCCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2N3/c1-15-11-9(13)8-10(14)12(16-11)17-6-4-2-3-5-7-17/h8H,2-7H2,1H3,(H,15,16) |
| InChIKey | JYZDPEAYNVJMAP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |